C19H17ClFNO2 — CID 90426954
2-[[2-(2-chloro-3-pyridinyl)cyclohexen-1-yl]methoxy]-6-fluorobenzaldehyde (PubChem CID 90426954) has the molecular formula C19H17ClFNO2 and a molecular weight of 345.80 g/mol. Its IUPAC name is 2-[[2-(2-chloro-3-pyridinyl)cyclohexen-1-yl]methoxy]-6-fluorobenzaldehyde.
| Compound Name | 2-[[2-(2-chloro-3-pyridinyl)cyclohexen-1-yl]methoxy]-6-fluorobenzaldehyde |
|---|---|
| PubChem CID | 90426954 |
| Molecular Formula | C19H17ClFNO2 |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[[2-(2-chloro-3-pyridinyl)cyclohexen-1-yl]methoxy]-6-fluorobenzaldehyde |
| SMILES | O=Cc1c(F)cccc1OCC1=C(c2cccnc2Cl)CCCC1 |
| InChI | InChI=1S/C19H17ClFNO2/c20-19-15(7-4-10-22-19)14-6-2-1-5-13(14)12-24-18-9-3-8-17(21)16(18)11-23/h3-4,7-11H,1-2,5-6,12H2 |
| InChIKey | DOKAUHJZLPJDAD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|