C20H20ClNO3 — CID 90427296
5-[[2-(2-chlorophenyl)cyclohexen-1-yl]methoxy]-2-methoxypyridine-4-carbaldehyde (PubChem CID 90427296) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is 5-[[2-(2-chlorophenyl)cyclohexen-1-yl]methoxy]-2-methoxypyridine-4-carbaldehyde.
| Compound Name | 5-[[2-(2-chlorophenyl)cyclohexen-1-yl]methoxy]-2-methoxypyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 90427296 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 5-[[2-(2-chlorophenyl)cyclohexen-1-yl]methoxy]-2-methoxypyridine-4-carbaldehyde |
| SMILES | COc1cc(C=O)c(OCC2=C(c3ccccc3Cl)CCCC2)cn1 |
| InChI | InChI=1S/C20H20ClNO3/c1-24-20-10-15(12-23)19(11-22-20)25-13-14-6-2-3-7-16(14)17-8-4-5-9-18(17)21/h4-5,8-12H,2-3,6-7,13H2,1H3 |
| InChIKey | BVUDKDGYLPIHQB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|