C19H23F2N3O3 — CID 123883405
5-[[2-[2-(2,2-difluoroethyl)-3,4-dihydropyrazol-3-yl]cyclohexen-1-yl]methoxy]-2-methoxypyridine-4-carbaldehyde (PubChem CID 123883405) has the molecular formula C19H23F2N3O3 and a molecular weight of 379.41 g/mol. Its IUPAC name is 5-[[2-[2-(2,2-difluoroethyl)-3,4-dihydropyrazol-3-yl]cyclohexen-1-yl]methoxy]-2-methoxypyridine-4-carbaldehyde.
| Compound Name | 5-[[2-[2-(2,2-difluoroethyl)-3,4-dihydropyrazol-3-yl]cyclohexen-1-yl]methoxy]-2-methoxypyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 123883405 |
| Molecular Formula | C19H23F2N3O3 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 5-[[2-[2-(2,2-difluoroethyl)-3,4-dihydropyrazol-3-yl]cyclohexen-1-yl]methoxy]-2-methoxypyridine-4-carbaldehyde |
| SMILES | COc1cc(C=O)c(OCC2=C(C3CC=NN3CC(F)F)CCCC2)cn1 |
| InChI | InChI=1S/C19H23F2N3O3/c1-26-19-8-14(11-25)17(9-22-19)27-12-13-4-2-3-5-15(13)16-6-7-23-24(16)10-18(20)21/h7-9,11,16,18H,2-6,10,12H2,1H3 |
| InChIKey | XUKZMNCNWRMKFQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|