C21H31NO5 — CID 90434078
5-[[2-(2-hydroxypentan-2-yl)cyclohexen-1-yl]methoxy]-2-(2-methoxyethoxy)pyridine-4-carbaldehyde (PubChem CID 90434078) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is 5-[[2-(2-hydroxypentan-2-yl)cyclohexen-1-yl]methoxy]-2-(2-methoxyethoxy)pyridine-4-carbaldehyde.
| Compound Name | 5-[[2-(2-hydroxypentan-2-yl)cyclohexen-1-yl]methoxy]-2-(2-methoxyethoxy)pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 90434078 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 5-[[2-(2-hydroxypentan-2-yl)cyclohexen-1-yl]methoxy]-2-(2-methoxyethoxy)pyridine-4-carbaldehyde |
| SMILES | CCCC(C)(O)C1=C(COc2cnc(OCCOC)cc2C=O)CCCC1 |
| InChI | InChI=1S/C21H31NO5/c1-4-9-21(2,24)18-8-6-5-7-16(18)15-27-19-13-22-20(12-17(19)14-23)26-11-10-25-3/h12-14,24H,4-11,15H2,1-3H3 |
| InChIKey | IZXGSQMMGCVVOA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|