C21H25N3O2 — CID 90434278
3-[[2-(2-cyclobutylpyrazol-3-yl)cyclohexen-1-yl]methoxy]-6-methylpyridine-2-carbaldehyde (PubChem CID 90434278) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-[[2-(2-cyclobutylpyrazol-3-yl)cyclohexen-1-yl]methoxy]-6-methylpyridine-2-carbaldehyde.
| Compound Name | 3-[[2-(2-cyclobutylpyrazol-3-yl)cyclohexen-1-yl]methoxy]-6-methylpyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 90434278 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 3-[[2-(2-cyclobutylpyrazol-3-yl)cyclohexen-1-yl]methoxy]-6-methylpyridine-2-carbaldehyde |
| SMILES | Cc1ccc(OCC2=C(c3ccnn3C3CCC3)CCCC2)c(C=O)n1 |
| InChI | InChI=1S/C21H25N3O2/c1-15-9-10-21(19(13-25)23-15)26-14-16-5-2-3-8-18(16)20-11-12-22-24(20)17-6-4-7-17/h9-13,17H,2-8,14H2,1H3 |
| InChIKey | MMDJCNNCWYPESZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|