About CID 144710157
CID 144710157 (PubChem CID 144710157) has the molecular formula C24H18B6F5N5O
and a molecular weight of 552.30 g/mol.
Molecular Properties
| Compound Name | CID 144710157 |
| PubChem CID | 144710157 |
| Molecular Formula | C24H18B6F5N5O |
| Molecular Weight | 552.30 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])c1noc(C([B])([B])[B])c1-c1cnc2c(-c3cnn(CC(F)(F)F)c3)cn(CC3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C24H18B6F5N5O/c25-23(26,27)19-17(20(41-38-19)24(28,29)30)13-5-16-18(36-6-13)15(14-7-37-40(9-14)11-22(33,34)35)10-39(16)8-12-1-3-21(31,32)4-2-12/h5-7,9-10,12H,1-4,8,11H2 |
| InChIKey | KPYLTDRATMJLLH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 552.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 144710157 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144710157?
The IUPAC name of CID 144710157 (CID 144710157) is not available.
What is the SMILES notation for CID 144710157?
The canonical SMILES for CID 144710157 is [B]C([B])([B])c1noc(C([B])([B])[B])c1-c1cnc2c(-c3cnn(CC(F)(F)F)c3)cn(CC3CCC(F)(F)CC3)c2c1.
What is the InChIKey of CID 144710157?
The InChIKey is KPYLTDRATMJLLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18B6F5N5O/c25-23(26,27)19-17(20(41-38-19)24(28,29)30)13-5-16-18(36-6-13)15(14-7-37-40(9-14)11-22(33,34)35)10-39(16)8-12-1-3-21(31,32)4-2-12/h5-7,9-10,12H,1-4,8,11H2.
What are the key properties of CID 144710157?
CID 144710157 has a molecular weight of 552.30 g/mol, XLogP of 3.17, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144710157 is sourced from PubChem (CID 144710157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).