C24H18B6F5N5O — CID 144710157
CID 144710157 (PubChem CID 144710157) has the molecular formula C24H18B6F5N5O and a molecular weight of 552.30 g/mol.
| Compound Name | CID 144710157 |
|---|---|
| PubChem CID | 144710157 |
| Molecular Formula | C24H18B6F5N5O |
| Molecular Weight | 552.30 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])c1noc(C([B])([B])[B])c1-c1cnc2c(-c3cnn(CC(F)(F)F)c3)cn(CC3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C24H18B6F5N5O/c25-23(26,27)19-17(20(41-38-19)24(28,29)30)13-5-16-18(36-6-13)15(14-7-37-40(9-14)11-22(33,34)35)10-39(16)8-12-1-3-21(31,32)4-2-12/h5-7,9-10,12H,1-4,8,11H2 |
| InChIKey | KPYLTDRATMJLLH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|