C26H34FN7O2 — CID 144711064
(Z,3E)-N-[(Z)-3-cyclopropyl-1-(methylideneamino)oxyprop-1-enyl]-3-[(4-fluoro-2-methyl-1H-indol-5-yl)oxymethylimino]-1-(methylideneamino)-3-(4-methylpiperazin-1-yl)prop-1-en-1-amine (PubChem CID 144711064) has the molecular formula C26H34FN7O2 and a molecular weight of 495.60 g/mol. Its IUPAC name is (Z,3E)-N-[(Z)-3-cyclopropyl-1-(methylideneamino)oxyprop-1-enyl]-3-[(4-fluoro-2-methyl-1H-indol-5-yl)oxymethylimino]-1-(methylideneamino)-3-(4-methylpiperazin-1-yl)prop-1-en-1-amine.
| Compound Name | (Z,3E)-N-[(Z)-3-cyclopropyl-1-(methylideneamino)oxyprop-1-enyl]-3-[(4-fluoro-2-methyl-1H-indol-5-yl)oxymethylimino]-1-(methylideneamino)-3-(4-methylpiperazin-1-yl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 144711064 |
| Molecular Formula | C26H34FN7O2 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | (Z,3E)-N-[(Z)-3-cyclopropyl-1-(methylideneamino)oxyprop-1-enyl]-3-[(4-fluoro-2-methyl-1H-indol-5-yl)oxymethylimino]-1-(methylideneamino)-3-(4-methylpiperazin-1-yl)prop-1-en-1-amine |
| SMILES | C=NO/C(=C\CC1CC1)N/C(=C/C(=N\COc1ccc2[nH]c(C)cc2c1F)N1CCN(C)CC1)N=C |
| InChI | InChI=1S/C26H34FN7O2/c1-18-15-20-21(31-18)8-9-22(26(20)27)35-17-30-24(34-13-11-33(4)12-14-34)16-23(28-2)32-25(36-29-3)10-7-19-5-6-19/h8-10,15-16,19,31-32H,2-3,5-7,11-14,17H2,1,4H3/b23-16+,25-10-,30-24+ |
| InChIKey | HQXBTNZSILMNQY-IQZWJSRQSA-N |
| XLogP | 4.00 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|