About (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol
(3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol (PubChem CID 144712092) has the molecular formula C15H31NOS
and a molecular weight of 273.49 g/mol. Its IUPAC name is (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol.
Molecular Properties
| Compound Name | (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol |
| PubChem CID | 144712092 |
| Molecular Formula | C15H31NOS |
| Molecular Weight | 273.49 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol |
| SMILES | C=C(O)[C@@H](CCS)CCCCCNCC(C)(C)C |
| InChI | InChI=1S/C15H31NOS/c1-13(17)14(9-11-18)8-6-5-7-10-16-12-15(2,3)4/h14,16-18H,1,5-12H2,2-4H3/t14-/m1/s1 |
| InChIKey | LLEOSDQMDGIVCG-CQSZACIVSA-N |
| XLogP | 4.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol?
The IUPAC name of (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol (CID 144712092) is (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol.
What is the SMILES notation for (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol?
The canonical SMILES for (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol is C=C(O)[C@@H](CCS)CCCCCNCC(C)(C)C.
What is the InChIKey of (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol?
The InChIKey is LLEOSDQMDGIVCG-CQSZACIVSA-N. The full InChI is InChI=1S/C15H31NOS/c1-13(17)14(9-11-18)8-6-5-7-10-16-12-15(2,3)4/h14,16-18H,1,5-12H2,2-4H3/t14-/m1/s1.
What are the key properties of (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol?
(3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol has a molecular weight of 273.49 g/mol, XLogP of 4.19, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-8-(2,2-dimethylpropylamino)-3-(2-sulfanylethyl)oct-1-en-2-ol is sourced from PubChem (CID 144712092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).