C16H33NO — CID 144711875
(3S)-8-(2,2-dimethylpropylamino)-3-propyloct-1-en-2-ol (PubChem CID 144711875) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is (3S)-8-(2,2-dimethylpropylamino)-3-propyloct-1-en-2-ol.
| Compound Name | (3S)-8-(2,2-dimethylpropylamino)-3-propyloct-1-en-2-ol |
|---|---|
| PubChem CID | 144711875 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | (3S)-8-(2,2-dimethylpropylamino)-3-propyloct-1-en-2-ol |
| SMILES | C=C(O)[C@@H](CCC)CCCCCNCC(C)(C)C |
| InChI | InChI=1S/C16H33NO/c1-6-10-15(14(2)18)11-8-7-9-12-17-13-16(3,4)5/h15,17-18H,2,6-13H2,1,3-5H3/t15-/m0/s1 |
| InChIKey | RSIJVNAHLGCMSN-HNNXBMFYSA-N |
| XLogP | 4.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|