C18H35NO2 — CID 39776337
(6S)-8-[(2-hydroxy-2-prop-2-enylpent-4-enyl)amino]-2,6-dimethyloctan-2-ol (PubChem CID 39776337) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is (6S)-8-[(2-hydroxy-2-prop-2-enylpent-4-enyl)amino]-2,6-dimethyloctan-2-ol.
| Compound Name | (6S)-8-[(2-hydroxy-2-prop-2-enylpent-4-enyl)amino]-2,6-dimethyloctan-2-ol |
|---|---|
| PubChem CID | 39776337 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | (6S)-8-[(2-hydroxy-2-prop-2-enylpent-4-enyl)amino]-2,6-dimethyloctan-2-ol |
| SMILES | C=CCC(O)(CC=C)CNCC[C@@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C18H35NO2/c1-6-11-18(21,12-7-2)15-19-14-10-16(3)9-8-13-17(4,5)20/h6-7,16,19-21H,1-2,8-15H2,3-5H3/t16-/m0/s1 |
| InChIKey | IVUSDQNZHOZQNJ-INIZCTEOSA-N |
| XLogP | 3.43 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|