C15H31NO — CID 170636685
(4R)-2,3,4-trimethyl-4-(propan-2-ylamino)non-8-en-3-ol (PubChem CID 170636685) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is (4R)-2,3,4-trimethyl-4-(propan-2-ylamino)non-8-en-3-ol.
| Compound Name | (4R)-2,3,4-trimethyl-4-(propan-2-ylamino)non-8-en-3-ol |
|---|---|
| PubChem CID | 170636685 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | (4R)-2,3,4-trimethyl-4-(propan-2-ylamino)non-8-en-3-ol |
| SMILES | C=CCCC[C@@](C)(NC(C)C)C(C)(O)C(C)C |
| InChI | InChI=1S/C15H31NO/c1-8-9-10-11-14(6,16-13(4)5)15(7,17)12(2)3/h8,12-13,16-17H,1,9-11H2,2-7H3/t14-,15?/m1/s1 |
| InChIKey | NDPMTESJNNSDML-GICMACPYSA-N |
| XLogP | 3.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|