C42H83NO2 — CID 54353200
3-[[2-(2-hydroxypropan-2-yl)octadec-9-enylamino]methyl]-2-methylnonadec-10-en-2-ol (PubChem CID 54353200) has the molecular formula C42H83NO2 and a molecular weight of 634.13 g/mol. Its IUPAC name is 3-[[2-(2-hydroxypropan-2-yl)octadec-9-enylamino]methyl]-2-methylnonadec-10-en-2-ol.
| Compound Name | 3-[[2-(2-hydroxypropan-2-yl)octadec-9-enylamino]methyl]-2-methylnonadec-10-en-2-ol |
|---|---|
| PubChem CID | 54353200 |
| Molecular Formula | C42H83NO2 |
| Molecular Weight | 634.13 g/mol |
| Exact Mass | 633.64 |
| IUPAC Name | 3-[[2-(2-hydroxypropan-2-yl)octadec-9-enylamino]methyl]-2-methylnonadec-10-en-2-ol |
| SMILES | CCCCCCCCC=CCCCCCCC(CNCC(CCCCCCC=CCCCCCCCC)C(C)(C)O)C(C)(C)O |
| InChI | InChI=1S/C42H83NO2/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39(41(3,4)44)37-43-38-40(42(5,6)45)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2/h21-24,39-40,43-45H,7-20,25-38H2,1-6H3 |
| InChIKey | UHFPKILOPMVAAL-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.13 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|