C42H84N3O2+ — CID 58581946
3-[[8-[(1R)-6-[(Z)-10-amino-10-hydroxydec-1-enyl]-4,5-dihexylcyclohex-2-en-1-yl]-1-hydroxyoctyl]amino]propyl-trimethylazanium (PubChem CID 58581946) has the molecular formula C42H84N3O2+ and a molecular weight of 663.15 g/mol. Its IUPAC name is 3-[[8-[(1R)-6-[(Z)-10-amino-10-hydroxydec-1-enyl]-4,5-dihexylcyclohex-2-en-1-yl]-1-hydroxyoctyl]amino]propyl-trimethylazanium.
| Compound Name | 3-[[8-[(1R)-6-[(Z)-10-amino-10-hydroxydec-1-enyl]-4,5-dihexylcyclohex-2-en-1-yl]-1-hydroxyoctyl]amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 58581946 |
| Molecular Formula | C42H84N3O2+ |
| Molecular Weight | 663.15 g/mol |
| Exact Mass | 662.66 |
| IUPAC Name | 3-[[8-[(1R)-6-[(Z)-10-amino-10-hydroxydec-1-enyl]-4,5-dihexylcyclohex-2-en-1-yl]-1-hydroxyoctyl]amino]propyl-trimethylazanium |
| SMILES | CCCCCCC1C=C[C@@H](CCCCCCCC(O)NCCC[N+](C)(C)C)C(/C=C\CCCCCCCC(N)O)C1CCCCCC |
| InChI | InChI=1S/C42H84N3O2/c1-6-8-10-20-27-37-33-34-38(28-21-16-15-19-25-32-42(47)44-35-26-36-45(3,4)5)40(39(37)29-22-11-9-7-2)30-23-17-13-12-14-18-24-31-41(43)46/h23,30,33-34,37-42,44,46-47H,6-22,24-29,31-32,35-36,43H2,1-5H3/q+1/b30-23-/t37?,38-,39?,40?,41?,42?/m1/s1 |
| InChIKey | XVHQASWGDVKKDP-MRFXJXBHSA-N |
| XLogP | 10.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.15 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|