C48H96N4O2+2 — CID 58823254
3-[[(2Z)-2-[[5,6-dihexyl-2-[8-hydroxy-8-[3-(trimethylazaniumyl)propylamino]octyl]cyclohex-3-en-1-yl]methylidene]cyclooctyl]methoxyamino]propyl-trimethylazanium (PubChem CID 58823254) has the molecular formula C48H96N4O2+2 and a molecular weight of 761.32 g/mol. Its IUPAC name is 3-[[(2Z)-2-[[5,6-dihexyl-2-[8-hydroxy-8-[3-(trimethylazaniumyl)propylamino]octyl]cyclohex-3-en-1-yl]methylidene]cyclooctyl]methoxyamino]propyl-trimethylazanium.
| Compound Name | 3-[[(2Z)-2-[[5,6-dihexyl-2-[8-hydroxy-8-[3-(trimethylazaniumyl)propylamino]octyl]cyclohex-3-en-1-yl]methylidene]cyclooctyl]methoxyamino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 58823254 |
| Molecular Formula | C48H96N4O2+2 |
| Molecular Weight | 761.32 g/mol |
| Exact Mass | 760.75 |
| IUPAC Name | 3-[[(2Z)-2-[[5,6-dihexyl-2-[8-hydroxy-8-[3-(trimethylazaniumyl)propylamino]octyl]cyclohex-3-en-1-yl]methylidene]cyclooctyl]methoxyamino]propyl-trimethylazanium |
| SMILES | CCCCCCC1C=CC(CCCCCCCC(O)NCCC[N+](C)(C)C)C(/C=C2/CCCCCCC2CONCCC[N+](C)(C)C)C1CCCCCC |
| InChI | InChI=1S/C48H96N4O2/c1-9-11-13-20-28-42-34-35-43(29-21-16-15-17-25-33-48(53)49-36-26-38-51(3,4)5)47(46(42)32-24-14-12-10-2)40-44-30-22-18-19-23-31-45(44)41-54-50-37-27-39-52(6,7)8/h34-35,40,42-43,45-50,53H,9-33,36-39,41H2,1-8H3/q+2/b44-40- |
| InChIKey | AAXCABBTWKYSCK-ZJWNILRBSA-N |
| XLogP | 11.21 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.32 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|