C10H19NO2 — CID 163446773
1-(3,6-dimethylcyclohex-2-en-1-yl)-1-hydroxy-N-methylmethanamine oxide (PubChem CID 163446773) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-(3,6-dimethylcyclohex-2-en-1-yl)-1-hydroxy-N-methylmethanamine oxide.
| Compound Name | 1-(3,6-dimethylcyclohex-2-en-1-yl)-1-hydroxy-N-methylmethanamine oxide |
|---|---|
| PubChem CID | 163446773 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1-(3,6-dimethylcyclohex-2-en-1-yl)-1-hydroxy-N-methylmethanamine oxide |
| SMILES | CC1=CC(C(O)[NH+](C)[O-])C(C)CC1 |
| InChI | InChI=1S/C10H19NO2/c1-7-4-5-8(2)9(6-7)10(12)11(3)13/h6,8-12H,4-5H2,1-3H3 |
| InChIKey | BDEFPYQBABLZQL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 47.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|