C10H19NO — CID 143624376
amino-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol (PubChem CID 143624376) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is amino-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol.
| Compound Name | amino-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol |
|---|---|
| PubChem CID | 143624376 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | amino-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol |
| SMILES | CC1=CC(C)CC(C)C1C(N)O |
| InChI | InChI=1S/C10H19NO/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4,6,8-10,12H,5,11H2,1-3H3 |
| InChIKey | RSPMXRRQRAEJEM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|