C11H19NO — CID 91325232
1-amino-4-cyclohexa-1,5-dien-1-ylpentan-1-ol (PubChem CID 91325232) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-amino-4-cyclohexa-1,5-dien-1-ylpentan-1-ol.
| Compound Name | 1-amino-4-cyclohexa-1,5-dien-1-ylpentan-1-ol |
|---|---|
| PubChem CID | 91325232 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-amino-4-cyclohexa-1,5-dien-1-ylpentan-1-ol |
| SMILES | CC(CCC(N)O)C1=CCCC=C1 |
| InChI | InChI=1S/C11H19NO/c1-9(7-8-11(12)13)10-5-3-2-4-6-10/h3,5-6,9,11,13H,2,4,7-8,12H2,1H3 |
| InChIKey | YVXYVZCELVWSGU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|