C14H21NO — CID 88903986
(4Z)-1-amino-4-(3-methylcyclohexa-1,5-dien-1-yl)hepta-4,6-dien-1-ol (PubChem CID 88903986) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (4Z)-1-amino-4-(3-methylcyclohexa-1,5-dien-1-yl)hepta-4,6-dien-1-ol.
| Compound Name | (4Z)-1-amino-4-(3-methylcyclohexa-1,5-dien-1-yl)hepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 88903986 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (4Z)-1-amino-4-(3-methylcyclohexa-1,5-dien-1-yl)hepta-4,6-dien-1-ol |
| SMILES | C=C/C=C(/CCC(N)O)C1=CC(C)CC=C1 |
| InChI | InChI=1S/C14H21NO/c1-3-5-12(8-9-14(15)16)13-7-4-6-11(2)10-13/h3-5,7,10-11,14,16H,1,6,8-9,15H2,2H3/b12-5- |
| InChIKey | YIKYAGNENYINKC-XGICHPGQSA-N |
| XLogP | 2.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|