C13H17NO — CID 91498711
3-(4,4a-dihydronaphthalen-2-yl)-1-aminopropan-1-ol (PubChem CID 91498711) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 3-(4,4a-dihydronaphthalen-2-yl)-1-aminopropan-1-ol.
| Compound Name | 3-(4,4a-dihydronaphthalen-2-yl)-1-aminopropan-1-ol |
|---|---|
| PubChem CID | 91498711 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-(4,4a-dihydronaphthalen-2-yl)-1-aminopropan-1-ol |
| SMILES | NC(O)CCC1=CCC2C=CC=CC2=C1 |
| InChI | InChI=1S/C13H17NO/c14-13(15)8-6-10-5-7-11-3-1-2-4-12(11)9-10/h1-5,9,11,13,15H,6-8,14H2 |
| InChIKey | ZKANSFQMHXMUGB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|