C15H30BNO — CID 176580826
CID 176580826 (PubChem CID 176580826) has the molecular formula C15H30BNO and a molecular weight of 251.22 g/mol.
| Compound Name | CID 176580826 |
|---|---|
| PubChem CID | 176580826 |
| Molecular Formula | C15H30BNO |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | — |
| SMILES | CC.CC.[B]C(/C=C\C)=C/C(=C)C(CN)CCO |
| InChI | InChI=1S/C11H18BNO.2C2H6/c1-3-4-11(12)7-9(2)10(8-13)5-6-14;2*1-2/h3-4,7,10,14H,2,5-6,8,13H2,1H3;2*1-2H3/b4-3-,11-7+;; |
| InChIKey | WLDDFUWBMUMQTM-YMBSYJFZSA-N |
| XLogP | 3.18 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|