C11H19NO — CID 142909421
4-amino-2-(6-methylcyclohexa-1,3-dien-1-yl)butan-1-ol (PubChem CID 142909421) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-amino-2-(6-methylcyclohexa-1,3-dien-1-yl)butan-1-ol.
| Compound Name | 4-amino-2-(6-methylcyclohexa-1,3-dien-1-yl)butan-1-ol |
|---|---|
| PubChem CID | 142909421 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-amino-2-(6-methylcyclohexa-1,3-dien-1-yl)butan-1-ol |
| SMILES | CC1CC=CC=C1C(CO)CCN |
| InChI | InChI=1S/C11H19NO/c1-9-4-2-3-5-11(9)10(8-13)6-7-12/h2-3,5,9-10,13H,4,6-8,12H2,1H3 |
| InChIKey | SBJQRPWVWAHLHB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |