C52H103N2O2+ — CID 162444084
[11-[4-hexyl-6-non-8-enyl-3-[(E)-oct-2-enyl]cyclohex-2-en-1-yl]-1-hydroxy-4-methylideneundecyl]azanium;2-methylpropane;1-(propan-2-ylamino)butan-1-ol (PubChem CID 162444084) has the molecular formula C52H103N2O2+ and a molecular weight of 788.41 g/mol. Its IUPAC name is [11-[4-hexyl-6-non-8-enyl-3-[(E)-oct-2-enyl]cyclohex-2-en-1-yl]-1-hydroxy-4-methylideneundecyl]azanium;2-methylpropane;1-(propan-2-ylamino)butan-1-ol.
| Compound Name | [11-[4-hexyl-6-non-8-enyl-3-[(E)-oct-2-enyl]cyclohex-2-en-1-yl]-1-hydroxy-4-methylideneundecyl]azanium;2-methylpropane;1-(propan-2-ylamino)butan-1-ol |
|---|---|
| PubChem CID | 162444084 |
| Molecular Formula | C52H103N2O2+ |
| Molecular Weight | 788.41 g/mol |
| Exact Mass | 787.80 |
| IUPAC Name | [11-[4-hexyl-6-non-8-enyl-3-[(E)-oct-2-enyl]cyclohex-2-en-1-yl]-1-hydroxy-4-methylideneundecyl]azanium;2-methylpropane;1-(propan-2-ylamino)butan-1-ol |
| SMILES | C=CCCCCCCCC1CC(CCCCCC)C(C/C=C/CCCCC)=CC1CCCCCCCC(=C)CCC([NH3+])O.CC(C)C.CCCC(O)NC(C)C |
| InChI | InChI=1S/C41H75NO.C7H17NO.C4H10/c1-5-8-11-14-16-20-25-30-39-34-37(28-23-13-10-7-3)38(29-24-19-15-12-9-6-2)35-40(39)31-26-21-17-18-22-27-36(4)32-33-41(42)43;1-4-5-7(9)8-6(2)3;1-4(2)3/h5,19,24,35,37,39-41,43H,1,4,6-18,20-23,25-34,42H2,2-3H3;6-9H,4-5H2,1-3H3;4H,1-3H3/p+1/b24-19+;; |
| InChIKey | XCVSREFEMJCCJZ-YCQUHOTGSA-O |
| XLogP | 14.97 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.41 |
| LogP ≤ 5 | 14.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|