C21H44NOY- — CID 169203527
N-ethylbutan-1-amine;10-methyl-8-methylidenetridecan-1-ol;yttrium (PubChem CID 169203527) has the molecular formula C21H44NOY- and a molecular weight of 415.50 g/mol. Its IUPAC name is N-ethylbutan-1-amine;10-methyl-8-methylidenetridecan-1-ol;yttrium.
| Compound Name | N-ethylbutan-1-amine;10-methyl-8-methylidenetridecan-1-ol;yttrium |
|---|---|
| PubChem CID | 169203527 |
| Molecular Formula | C21H44NOY- |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | N-ethylbutan-1-amine;10-methyl-8-methylidenetridecan-1-ol;yttrium |
| SMILES | C=C(CCCCCCCO)CC(C)CCC.C[CH-]NCCCC.[Y] |
| InChI | InChI=1S/C15H30O.C6H14N.Y/c1-4-10-14(2)13-15(3)11-8-6-5-7-9-12-16;1-3-5-6-7-4-2;/h14,16H,3-13H2,1-2H3;4,7H,3,5-6H2,1-2H3;/q;-1; |
| InChIKey | YCJXMAPUORKMCU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|