C52H103NO — CID 170636143
2,6,15,19,23-pentamethyl-26-methylidene-1-(undec-1-en-2-ylamino)pentatriacontan-11-ol (PubChem CID 170636143) has the molecular formula C52H103NO and a molecular weight of 758.40 g/mol. Its IUPAC name is 2,6,15,19,23-pentamethyl-26-methylidene-1-(undec-1-en-2-ylamino)pentatriacontan-11-ol.
| Compound Name | 2,6,15,19,23-pentamethyl-26-methylidene-1-(undec-1-en-2-ylamino)pentatriacontan-11-ol |
|---|---|
| PubChem CID | 170636143 |
| Molecular Formula | C52H103NO |
| Molecular Weight | 758.40 g/mol |
| Exact Mass | 757.80 |
| IUPAC Name | 2,6,15,19,23-pentamethyl-26-methylidene-1-(undec-1-en-2-ylamino)pentatriacontan-11-ol |
| SMILES | C=C(CCCCCCCCC)CCC(C)CCCC(C)CCCC(C)CCCC(O)CCCCC(C)CCCC(C)CNC(=C)CCCCCCCCC |
| InChI | InChI=1S/C52H103NO/c1-10-12-14-16-18-20-22-30-48(6)42-43-49(7)36-27-34-46(4)32-26-33-47(5)37-29-41-52(54)40-25-24-31-45(3)35-28-38-50(8)44-53-51(9)39-23-21-19-17-15-13-11-2/h45-47,49-50,52-54H,6,9-44H2,1-5,7-8H3 |
| InChIKey | XJTCAGPEMCFABW-UHFFFAOYSA-N |
| XLogP | 17.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.40 |
| LogP ≤ 5 | 17.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|