C16H14FIN6O — CID 144712616
1-[5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazol-1-yl]-2-(imino-λ3-iodanyl)ethanone (PubChem CID 144712616) has the molecular formula C16H14FIN6O and a molecular weight of 452.23 g/mol. Its IUPAC name is 1-[5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazol-1-yl]-2-(imino-λ3-iodanyl)ethanone.
| Compound Name | 1-[5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazol-1-yl]-2-(imino-λ3-iodanyl)ethanone |
|---|---|
| PubChem CID | 144712616 |
| Molecular Formula | C16H14FIN6O |
| Molecular Weight | 452.23 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 1-[5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazol-1-yl]-2-(imino-λ3-iodanyl)ethanone |
| SMILES | [H]/N=I/CC(=O)n1nc(-c2cccnc2)nc1NCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FIN6O/c17-13-5-3-11(4-6-13)9-21-16-22-15(12-2-1-7-20-10-12)23-24(16)14(25)8-18-19/h1-7,10,19H,8-9H2,(H,21,22,23) |
| InChIKey | BMHMYNFQGCOREW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|