C18H16FN5O — CID 163484530
1-[5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazol-1-yl]but-3-en-1-one (PubChem CID 163484530) has the molecular formula C18H16FN5O and a molecular weight of 337.36 g/mol. Its IUPAC name is 1-[5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazol-1-yl]but-3-en-1-one.
| Compound Name | 1-[5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazol-1-yl]but-3-en-1-one |
|---|---|
| PubChem CID | 163484530 |
| Molecular Formula | C18H16FN5O |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1-[5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazol-1-yl]but-3-en-1-one |
| SMILES | C=CCC(=O)n1nc(-c2cccnc2)nc1NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FN5O/c1-2-4-16(25)24-18(21-11-13-6-8-15(19)9-7-13)22-17(23-24)14-5-3-10-20-12-14/h2-3,5-10,12H,1,4,11H2,(H,21,22,23) |
| InChIKey | CHLFZYPXXICYNN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|