C7H11F2N — CID 144713079
1-[(1S)-3,3-difluorocyclopentyl]ethanimine (PubChem CID 144713079) has the molecular formula C7H11F2N and a molecular weight of 147.17 g/mol. Its IUPAC name is 1-[(1S)-3,3-difluorocyclopentyl]ethanimine.
| Compound Name | 1-[(1S)-3,3-difluorocyclopentyl]ethanimine |
|---|---|
| PubChem CID | 144713079 |
| Molecular Formula | C7H11F2N |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 1-[(1S)-3,3-difluorocyclopentyl]ethanimine |
| SMILES | [H]/N=C(\C)[C@H]1CCC(F)(F)C1 |
| InChI | InChI=1S/C7H11F2N/c1-5(10)6-2-3-7(8,9)4-6/h6,10H,2-4H2,1H3/b10-5+/t6-/m0/s1 |
| InChIKey | ZRVXRNGDGJSOBF-UEEORIODSA-N |
| XLogP | 2.46 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|