C47H54F8O — CID 144714440
2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]benzene;ethane;1-ethenyl-4-(4-propylcyclohexyl)cyclohexane (PubChem CID 144714440) has the molecular formula C47H54F8O and a molecular weight of 786.93 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]benzene;ethane;1-ethenyl-4-(4-propylcyclohexyl)cyclohexane.
| Compound Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]benzene;ethane;1-ethenyl-4-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 144714440 |
| Molecular Formula | C47H54F8O |
| Molecular Weight | 786.93 g/mol |
| Exact Mass | 786.40 |
| IUPAC Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]benzene;ethane;1-ethenyl-4-(4-propylcyclohexyl)cyclohexane |
| SMILES | C=CC1CCC(C2CCC(CCC)CC2)CC1.CC.CCCc1ccc(-c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H18F8O.C17H30.C2H6/c1-2-3-15-4-6-16(7-5-15)17-8-9-20(21(29)10-17)18-11-22(30)26(23(31)12-18)28(35,36)37-19-13-24(32)27(34)25(33)14-19;1-3-5-15-8-12-17(13-9-15)16-10-6-14(4-2)7-11-16;1-2/h4-14H,2-3H2,1H3;4,14-17H,2-3,5-13H2,1H3;1-2H3 |
| InChIKey | RSTAVDSWTNOAAJ-UHFFFAOYSA-N |
| XLogP | 15.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.93 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|