C38H43F7O — CID 159436323
2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-(4-ethylphenyl)-1,3-difluorobenzene;1-ethenyl-4-(4-propylcyclohexyl)cyclohexane (PubChem CID 159436323) has the molecular formula C38H43F7O and a molecular weight of 648.75 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-(4-ethylphenyl)-1,3-difluorobenzene;1-ethenyl-4-(4-propylcyclohexyl)cyclohexane.
| Compound Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-(4-ethylphenyl)-1,3-difluorobenzene;1-ethenyl-4-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 159436323 |
| Molecular Formula | C38H43F7O |
| Molecular Weight | 648.75 g/mol |
| Exact Mass | 648.32 |
| IUPAC Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-(4-ethylphenyl)-1,3-difluorobenzene;1-ethenyl-4-(4-propylcyclohexyl)cyclohexane |
| SMILES | C=CC1CCC(C2CCC(CCC)CC2)CC1.CCc1ccc(-c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C21H13F7O.C17H30/c1-2-11-3-5-12(6-4-11)13-7-15(22)19(16(23)8-13)21(27,28)29-14-9-17(24)20(26)18(25)10-14;1-3-5-15-8-12-17(13-9-15)16-10-6-14(4-2)7-11-16/h3-10H,2H2,1H3;4,14-17H,2-3,5-13H2,1H3 |
| InChIKey | LRPWCOFBOIHGNZ-UHFFFAOYSA-N |
| XLogP | 12.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.75 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|