C31H43N3O3 — CID 144715395
4-(dimethylamino)-N-[3-[2,5-dioxo-3-(1-phenylethyl)-4-(2,3,3-trimethylbutan-2-yl)pyrrolidin-1-yl]propyl]benzamide (PubChem CID 144715395) has the molecular formula C31H43N3O3 and a molecular weight of 505.70 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[3-[2,5-dioxo-3-(1-phenylethyl)-4-(2,3,3-trimethylbutan-2-yl)pyrrolidin-1-yl]propyl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[3-[2,5-dioxo-3-(1-phenylethyl)-4-(2,3,3-trimethylbutan-2-yl)pyrrolidin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 144715395 |
| Molecular Formula | C31H43N3O3 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | 4-(dimethylamino)-N-[3-[2,5-dioxo-3-(1-phenylethyl)-4-(2,3,3-trimethylbutan-2-yl)pyrrolidin-1-yl]propyl]benzamide |
| SMILES | CC(c1ccccc1)C1C(=O)N(CCCNC(=O)c2ccc(N(C)C)cc2)C(=O)C1C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H43N3O3/c1-21(22-13-10-9-11-14-22)25-26(31(5,6)30(2,3)4)29(37)34(28(25)36)20-12-19-32-27(35)23-15-17-24(18-16-23)33(7)8/h9-11,13-18,21,25-26H,12,19-20H2,1-8H3,(H,32,35) |
| InChIKey | WIZUASNGHHMNAC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|