C17H27FN2O5 — CID 144716297
tert-butyl 3-[[(2-acetyloxyacetyl)-prop-2-enylamino]methyl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 144716297) has the molecular formula C17H27FN2O5 and a molecular weight of 358.41 g/mol. Its IUPAC name is tert-butyl 3-[[(2-acetyloxyacetyl)-prop-2-enylamino]methyl]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(2-acetyloxyacetyl)-prop-2-enylamino]methyl]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 144716297 |
| Molecular Formula | C17H27FN2O5 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | tert-butyl 3-[[(2-acetyloxyacetyl)-prop-2-enylamino]methyl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | C=CCN(CC1CN(C(=O)OC(C)(C)C)CC1F)C(=O)COC(C)=O |
| InChI | InChI=1S/C17H27FN2O5/c1-6-7-19(15(22)11-24-12(2)21)8-13-9-20(10-14(13)18)16(23)25-17(3,4)5/h6,13-14H,1,7-11H2,2-5H3 |
| InChIKey | AWIAMIOMFKQRBM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|