C21H22FN5O2 — CID 144717991
benzyl N-[2-(5-amino-2-fluorophenyl)imidazo[1,2-a]pyrimidin-6-yl]carbamate;methane;molecular hydrogen (PubChem CID 144717991) has the molecular formula C21H22FN5O2 and a molecular weight of 395.44 g/mol. Its IUPAC name is benzyl N-[2-(5-amino-2-fluorophenyl)imidazo[1,2-a]pyrimidin-6-yl]carbamate;methane;molecular hydrogen.
| Compound Name | benzyl N-[2-(5-amino-2-fluorophenyl)imidazo[1,2-a]pyrimidin-6-yl]carbamate;methane;molecular hydrogen |
|---|---|
| PubChem CID | 144717991 |
| Molecular Formula | C21H22FN5O2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | benzyl N-[2-(5-amino-2-fluorophenyl)imidazo[1,2-a]pyrimidin-6-yl]carbamate;methane;molecular hydrogen |
| SMILES | C.Nc1ccc(F)c(-c2cn3cc(NC(=O)OCc4ccccc4)cnc3n2)c1.[H][H] |
| InChI | InChI=1S/C20H16FN5O2.CH4.H2/c21-17-7-6-14(22)8-16(17)18-11-26-10-15(9-23-19(26)25-18)24-20(27)28-12-13-4-2-1-3-5-13;;/h1-11H,12,22H2,(H,24,27);1H4;1H |
| InChIKey | JVGQLNBCSJGNFS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|