C22H27Cl2FN4O3 — CID 144720733
(3,5-dichlorophenyl)methyl formate;(4-fluoropiperidin-1-yl)-(5-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methanone (PubChem CID 144720733) has the molecular formula C22H27Cl2FN4O3 and a molecular weight of 485.39 g/mol. Its IUPAC name is (3,5-dichlorophenyl)methyl formate;(4-fluoropiperidin-1-yl)-(5-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methanone.
| Compound Name | (3,5-dichlorophenyl)methyl formate;(4-fluoropiperidin-1-yl)-(5-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methanone |
|---|---|
| PubChem CID | 144720733 |
| Molecular Formula | C22H27Cl2FN4O3 |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (3,5-dichlorophenyl)methyl formate;(4-fluoropiperidin-1-yl)-(5-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methanone |
| SMILES | CN1CCCn2nc(C(=O)N3CCC(F)CC3)cc2C1.O=COCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H21FN4O.C8H6Cl2O2/c1-17-5-2-6-19-12(10-17)9-13(16-19)14(20)18-7-3-11(15)4-8-18;9-7-1-6(4-12-5-11)2-8(10)3-7/h9,11H,2-8,10H2,1H3;1-3,5H,4H2 |
| InChIKey | GGMLRUSLPLBROY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|