C19H25F6N7O2 — CID 144720894
[3,5-bis(trifluoromethyl)phenyl]methyl formate;[hydrazinyl-(5-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]hydrazine (PubChem CID 144720894) has the molecular formula C19H25F6N7O2 and a molecular weight of 497.44 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl formate;[hydrazinyl-(5-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]hydrazine.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl formate;[hydrazinyl-(5-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 144720894 |
| Molecular Formula | C19H25F6N7O2 |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl formate;[hydrazinyl-(5-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]hydrazine |
| SMILES | CN1CCCn2nc(C(NN)NN)cc2C1.O=COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H6F6O2.C9H19N7/c11-9(12,13)7-1-6(4-18-5-17)2-8(3-7)10(14,15)16;1-15-3-2-4-16-7(6-15)5-8(14-16)9(12-10)13-11/h1-3,5H,4H2;5,9,12-13H,2-4,6,10-11H2,1H3 |
| InChIKey | VHYUQUYNMTXBNO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|