C19H21F6N3O3 — CID 144720765
2-(hydroxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carbaldehyde;1-(methoxymethyl)-3,5-bis(trifluoromethyl)benzene (PubChem CID 144720765) has the molecular formula C19H21F6N3O3 and a molecular weight of 453.38 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carbaldehyde;1-(methoxymethyl)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 2-(hydroxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carbaldehyde;1-(methoxymethyl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 144720765 |
| Molecular Formula | C19H21F6N3O3 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-(hydroxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carbaldehyde;1-(methoxymethyl)-3,5-bis(trifluoromethyl)benzene |
| SMILES | COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1.O=CN1CCCn2nc(CO)cc2C1 |
| InChI | InChI=1S/C10H8F6O.C9H13N3O2/c1-17-5-6-2-7(9(11,12)13)4-8(3-6)10(14,15)16;13-6-8-4-9-5-11(7-14)2-1-3-12(9)10-8/h2-4H,5H2,1H3;4,7,13H,1-3,5-6H2 |
| InChIKey | LDOVVLQUXGTOTJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|