C18H24Cl2N4O3 — CID 144720722
1,3-dichloro-5-(methoxymethyl)benzene;methanamine;4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2,5-dicarbaldehyde (PubChem CID 144720722) has the molecular formula C18H24Cl2N4O3 and a molecular weight of 415.32 g/mol. Its IUPAC name is 1,3-dichloro-5-(methoxymethyl)benzene;methanamine;4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2,5-dicarbaldehyde.
| Compound Name | 1,3-dichloro-5-(methoxymethyl)benzene;methanamine;4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2,5-dicarbaldehyde |
|---|---|
| PubChem CID | 144720722 |
| Molecular Formula | C18H24Cl2N4O3 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1,3-dichloro-5-(methoxymethyl)benzene;methanamine;4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2,5-dicarbaldehyde |
| SMILES | CN.COCc1cc(Cl)cc(Cl)c1.O=Cc1cc2n(n1)CCCN(C=O)C2 |
| InChI | InChI=1S/C9H11N3O2.C8H8Cl2O.CH5N/c13-6-8-4-9-5-11(7-14)2-1-3-12(9)10-8;1-11-5-6-2-7(9)4-8(10)3-6;1-2/h4,6-7H,1-3,5H2;2-4H,5H2,1H3;2H2,1H3 |
| InChIKey | OMMHEPVCHPSPNX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|