C21H17BrF5N5O3 — CID 144721010
2-[5-[2-[amino-[(Z)-2-amino-1-[4-(trifluoromethoxy)phenyl]ethenyl]amino]-4-bromophenyl]-1-methylpyrazol-3-yl]-2,2-difluoroacetic acid (PubChem CID 144721010) has the molecular formula C21H17BrF5N5O3 and a molecular weight of 562.29 g/mol. Its IUPAC name is 2-[5-[2-[amino-[(Z)-2-amino-1-[4-(trifluoromethoxy)phenyl]ethenyl]amino]-4-bromophenyl]-1-methylpyrazol-3-yl]-2,2-difluoroacetic acid.
| Compound Name | 2-[5-[2-[amino-[(Z)-2-amino-1-[4-(trifluoromethoxy)phenyl]ethenyl]amino]-4-bromophenyl]-1-methylpyrazol-3-yl]-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 144721010 |
| Molecular Formula | C21H17BrF5N5O3 |
| Molecular Weight | 562.29 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | 2-[5-[2-[amino-[(Z)-2-amino-1-[4-(trifluoromethoxy)phenyl]ethenyl]amino]-4-bromophenyl]-1-methylpyrazol-3-yl]-2,2-difluoroacetic acid |
| SMILES | Cn1nc(C(F)(F)C(=O)O)cc1-c1ccc(Br)cc1N(N)/C(=C\N)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H17BrF5N5O3/c1-31-15(9-18(30-31)20(23,24)19(33)34)14-7-4-12(22)8-16(14)32(29)17(10-28)11-2-5-13(6-3-11)35-21(25,26)27/h2-10H,28-29H2,1H3,(H,33,34)/b17-10- |
| InChIKey | SWZWXAHCMXKPFI-YVLHZVERSA-N |
| XLogP | 4.56 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|