C22H19BrF5N3O5 — CID 144720980
ethyl 5-[2-[amino-[(Z)-2-amino-1-[4-(trifluoromethoxy)phenyl]ethenyl]amino]-4-bromophenyl]-2,2-difluoro-3,5-dioxopentanoate (PubChem CID 144720980) has the molecular formula C22H19BrF5N3O5 and a molecular weight of 580.30 g/mol. Its IUPAC name is ethyl 5-[2-[amino-[(Z)-2-amino-1-[4-(trifluoromethoxy)phenyl]ethenyl]amino]-4-bromophenyl]-2,2-difluoro-3,5-dioxopentanoate.
| Compound Name | ethyl 5-[2-[amino-[(Z)-2-amino-1-[4-(trifluoromethoxy)phenyl]ethenyl]amino]-4-bromophenyl]-2,2-difluoro-3,5-dioxopentanoate |
|---|---|
| PubChem CID | 144720980 |
| Molecular Formula | C22H19BrF5N3O5 |
| Molecular Weight | 580.30 g/mol |
| Exact Mass | 579.04 |
| IUPAC Name | ethyl 5-[2-[amino-[(Z)-2-amino-1-[4-(trifluoromethoxy)phenyl]ethenyl]amino]-4-bromophenyl]-2,2-difluoro-3,5-dioxopentanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)CC(=O)c1ccc(Br)cc1N(N)/C(=C\N)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H19BrF5N3O5/c1-2-35-20(34)21(24,25)19(33)10-18(32)15-8-5-13(23)9-16(15)31(30)17(11-29)12-3-6-14(7-4-12)36-22(26,27)28/h3-9,11H,2,10,29-30H2,1H3/b17-11- |
| InChIKey | MHCQEXKTKNQHAL-BOPFTXTBSA-N |
| XLogP | 4.33 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|