C17H33NO — CID 144721093
ethane;2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]cyclohexan-1-ol (PubChem CID 144721093) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is ethane;2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]cyclohexan-1-ol.
| Compound Name | ethane;2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 144721093 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | ethane;2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]cyclohexan-1-ol |
| SMILES | C=C/C=C(\C=C)CNC1CCCCC1O.CC.CC |
| InChI | InChI=1S/C13H21NO.2C2H6/c1-3-7-11(4-2)10-14-12-8-5-6-9-13(12)15;2*1-2/h3-4,7,12-15H,1-2,5-6,8-10H2;2*1-2H3/b11-7+;; |
| InChIKey | KHAUKXWLIKRMNE-FCVAESPPSA-N |
| XLogP | 4.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|