C23H45NO — CID 24936308
cis-(1S,2S,3Z)-2-(propylamino)-3-tetradecylidenecyclohexan-1-ol (PubChem CID 24936308) has the molecular formula C23H45NO and a molecular weight of 351.62 g/mol. Its IUPAC name is cis-(1S,2S,3Z)-2-(propylamino)-3-tetradecylidenecyclohexan-1-ol.
| Compound Name | cis-(1S,2S,3Z)-2-(propylamino)-3-tetradecylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 24936308 |
| Molecular Formula | C23H45NO |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 351.35 |
| IUPAC Name | cis-(1S,2S,3Z)-2-(propylamino)-3-tetradecylidenecyclohexan-1-ol |
| SMILES | CCCCCCCCCCCCC/C=C1/CCC[C@H](O)[C@H]1NCCC |
| InChI | InChI=1S/C23H45NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-21-18-16-19-22(25)23(21)24-20-4-2/h17,22-25H,3-16,18-20H2,1-2H3/b21-17-/t22-,23-/m0/s1 |
| InChIKey | MMSSRPUBNPVCRG-CNOHFIPDSA-N |
| XLogP | 6.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|