C13H24O — CID 177383761
(1R,2Z)-2-octylidenecyclopentan-1-ol (PubChem CID 177383761) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (1R,2Z)-2-octylidenecyclopentan-1-ol.
| Compound Name | (1R,2Z)-2-octylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 177383761 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (1R,2Z)-2-octylidenecyclopentan-1-ol |
| SMILES | CCCCCCC/C=C1/CCC[C@H]1O |
| InChI | InChI=1S/C13H24O/c1-2-3-4-5-6-7-9-12-10-8-11-13(12)14/h9,13-14H,2-8,10-11H2,1H3/b12-9-/t13-/m1/s1 |
| InChIKey | MNKOMZOVSBCAJO-KIWPFMIBSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|