C38H72N2O — CID 139470227
(8Z,12E)-N-(2-aminoethyl)-11-hexyl-12-nonylidenecycloicos-8-ene-1-carboxamide (PubChem CID 139470227) has the molecular formula C38H72N2O and a molecular weight of 573.01 g/mol. Its IUPAC name is (8Z,12E)-N-(2-aminoethyl)-11-hexyl-12-nonylidenecycloicos-8-ene-1-carboxamide.
| Compound Name | (8Z,12E)-N-(2-aminoethyl)-11-hexyl-12-nonylidenecycloicos-8-ene-1-carboxamide |
|---|---|
| PubChem CID | 139470227 |
| Molecular Formula | C38H72N2O |
| Molecular Weight | 573.01 g/mol |
| Exact Mass | 572.56 |
| IUPAC Name | (8Z,12E)-N-(2-aminoethyl)-11-hexyl-12-nonylidenecycloicos-8-ene-1-carboxamide |
| SMILES | CCCCCCCC/C=C1\CCCCCCCCC(C(=O)NCCN)CCCCCC/C=C\CC1CCCCCC |
| InChI | InChI=1S/C38H72N2O/c1-3-5-7-9-11-16-22-29-36-30-24-18-14-15-20-26-32-37(38(41)40-34-33-39)31-25-19-13-10-12-17-23-28-35(36)27-21-8-6-4-2/h17,23,29,35,37H,3-16,18-22,24-28,30-34,39H2,1-2H3,(H,40,41)/b23-17-,36-29+ |
| InChIKey | IEVFXPNRDSKVEQ-NHXMUWTLSA-N |
| XLogP | 11.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.01 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|