C69H129N3O3 — CID 87832718
1-N,3-N,5-N-tris[(Z)-icos-9-enyl]cyclohexane-1,3,5-tricarboxamide (PubChem CID 87832718) has the molecular formula C69H129N3O3 and a molecular weight of 1048.81 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris[(Z)-icos-9-enyl]cyclohexane-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris[(Z)-icos-9-enyl]cyclohexane-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 87832718 |
| Molecular Formula | C69H129N3O3 |
| Molecular Weight | 1048.81 g/mol |
| Exact Mass | 1048.00 |
| IUPAC Name | 1-N,3-N,5-N-tris[(Z)-icos-9-enyl]cyclohexane-1,3,5-tricarboxamide |
| SMILES | CCCCCCCCCC/C=C\CCCCCCCCNC(=O)C1CC(C(=O)NCCCCCCCC/C=C\CCCCCCCCCC)CC(C(=O)NCCCCCCCC/C=C\CCCCCCCCCC)C1 |
| InChI | InChI=1S/C69H129N3O3/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-55-58-70-67(73)64-61-65(68(74)71-59-56-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)63-66(62-64)69(75)72-60-57-54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h31-36,64-66H,4-30,37-63H2,1-3H3,(H,70,73)(H,71,74)(H,72,75)/b34-31-,35-32-,36-33- |
| InChIKey | QDISNYGHNXVANY-TUIVHVJNSA-N |
| XLogP | 20.82 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 57 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1048.81 |
| LogP ≤ 5 | 20.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|