C21H26N2O4S — CID 144721182
ethane;1-(5-ethyl-2-pyridinyl)-2-(4-methylphenoxy)ethanone;1,3-thiazolidine-2,4-dione (PubChem CID 144721182) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is ethane;1-(5-ethyl-2-pyridinyl)-2-(4-methylphenoxy)ethanone;1,3-thiazolidine-2,4-dione.
| Compound Name | ethane;1-(5-ethyl-2-pyridinyl)-2-(4-methylphenoxy)ethanone;1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 144721182 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | ethane;1-(5-ethyl-2-pyridinyl)-2-(4-methylphenoxy)ethanone;1,3-thiazolidine-2,4-dione |
| SMILES | CC.CCc1ccc(C(=O)COc2ccc(C)cc2)nc1.O=C1CSC(=O)N1 |
| InChI | InChI=1S/C16H17NO2.C3H3NO2S.C2H6/c1-3-13-6-9-15(17-10-13)16(18)11-19-14-7-4-12(2)5-8-14;5-2-1-7-3(6)4-2;1-2/h4-10H,3,11H2,1-2H3;1H2,(H,4,5,6);1-2H3 |
| InChIKey | WCMNQUAFMYBCDN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|