C19H17KN2O4S — CID 53354338
potassium 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione (PubChem CID 53354338) has the molecular formula C19H17KN2O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is potassium 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione.
| Compound Name | potassium 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione |
|---|---|
| PubChem CID | 53354338 |
| Molecular Formula | C19H17KN2O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | potassium 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione |
| SMILES | CCc1ccc(C(=O)COc2ccc(CC3SC(=O)[N-]C3=O)cc2)nc1.[K+] |
| InChI | InChI=1S/C19H18N2O4S.K/c1-2-12-5-8-15(20-10-12)16(22)11-25-14-6-3-13(4-7-14)9-17-18(23)21-19(24)26-17;/h3-8,10,17H,2,9,11H2,1H3,(H,21,23,24);/q;+1/p-1 |
| InChIKey | BITXWGSHQGLFDD-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 87.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|