C18H13NNa2O5S — CID 140645891
disodium;2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-3-id-5-yl)methyl]phenoxy]phenyl]acetate (PubChem CID 140645891) has the molecular formula C18H13NNa2O5S and a molecular weight of 401.35 g/mol. Its IUPAC name is disodium;2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-3-id-5-yl)methyl]phenoxy]phenyl]acetate.
| Compound Name | disodium;2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-3-id-5-yl)methyl]phenoxy]phenyl]acetate |
|---|---|
| PubChem CID | 140645891 |
| Molecular Formula | C18H13NNa2O5S |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | disodium;2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-3-id-5-yl)methyl]phenoxy]phenyl]acetate |
| SMILES | O=C([O-])Cc1ccc(Oc2ccc(CC3SC(=O)[N-]C3=O)cc2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C18H15NO5S.2Na/c20-16(21)10-12-3-7-14(8-4-12)24-13-5-1-11(2-6-13)9-15-17(22)19-18(23)25-15;;/h1-8,15H,9-10H2,(H2,19,20,21,22,23);;/q;2*+1/p-2 |
| InChIKey | XJNLVSNFAGAGOW-UHFFFAOYSA-L |
| XLogP | -3.54 |
| TPSA | 97.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|