C23H27BrCl2N4O — CID 144721679
5-cyclopropyl-4-[[1-[(3,5-dichlorophenyl)methyl]-4-methylpiperidin-4-yl]methoxy]-2-iminopyridine-1-carboximidoyl bromide (PubChem CID 144721679) has the molecular formula C23H27BrCl2N4O and a molecular weight of 526.31 g/mol. Its IUPAC name is 5-cyclopropyl-4-[[1-[(3,5-dichlorophenyl)methyl]-4-methylpiperidin-4-yl]methoxy]-2-iminopyridine-1-carboximidoyl bromide.
| Compound Name | 5-cyclopropyl-4-[[1-[(3,5-dichlorophenyl)methyl]-4-methylpiperidin-4-yl]methoxy]-2-iminopyridine-1-carboximidoyl bromide |
|---|---|
| PubChem CID | 144721679 |
| Molecular Formula | C23H27BrCl2N4O |
| Molecular Weight | 526.31 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | 5-cyclopropyl-4-[[1-[(3,5-dichlorophenyl)methyl]-4-methylpiperidin-4-yl]methoxy]-2-iminopyridine-1-carboximidoyl bromide |
| SMILES | [H]/N=C(\Br)n1cc(C2CC2)c(OCC2(C)CCN(Cc3cc(Cl)cc(Cl)c3)CC2)c/c1=N\[H] |
| InChI | InChI=1S/C23H27BrCl2N4O/c1-23(4-6-29(7-5-23)12-15-8-17(25)10-18(26)9-15)14-31-20-11-21(27)30(22(24)28)13-19(20)16-2-3-16/h8-11,13,16,27-28H,2-7,12,14H2,1H3/b27-21+,28-22+ |
| InChIKey | IPPLAUTVWMBHAX-GPAWKIAZSA-N |
| XLogP | 6.01 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.31 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|