C21H18ClNO5S — CID 144722072
1-chloro-4-methylbenzene;2-[(5Z)-2,4-dioxo-5-[[4-(2-oxoethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetaldehyde (PubChem CID 144722072) has the molecular formula C21H18ClNO5S and a molecular weight of 431.90 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene;2-[(5Z)-2,4-dioxo-5-[[4-(2-oxoethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetaldehyde.
| Compound Name | 1-chloro-4-methylbenzene;2-[(5Z)-2,4-dioxo-5-[[4-(2-oxoethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 144722072 |
| Molecular Formula | C21H18ClNO5S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 1-chloro-4-methylbenzene;2-[(5Z)-2,4-dioxo-5-[[4-(2-oxoethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetaldehyde |
| SMILES | Cc1ccc(Cl)cc1.O=CCOc1ccc(/C=C2\SC(=O)N(CC=O)C2=O)cc1 |
| InChI | InChI=1S/C14H11NO5S.C7H7Cl/c16-6-5-15-13(18)12(21-14(15)19)9-10-1-3-11(4-2-10)20-8-7-17;1-6-2-4-7(8)5-3-6/h1-4,6-7,9H,5,8H2;2-5H,1H3/b12-9-; |
| InChIKey | NCCLMXKCLXRKDV-MWMYENNMSA-N |
| XLogP | 4.15 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|