C25H38N4 — CID 144722224
2-[1-[1-[(5,5-dimethylcyclohexen-1-yl)methyl]piperidin-4-yl]benzimidazol-2-yl]-N-ethylethanamine (PubChem CID 144722224) has the molecular formula C25H38N4 and a molecular weight of 394.61 g/mol. Its IUPAC name is 2-[1-[1-[(5,5-dimethylcyclohexen-1-yl)methyl]piperidin-4-yl]benzimidazol-2-yl]-N-ethylethanamine.
| Compound Name | 2-[1-[1-[(5,5-dimethylcyclohexen-1-yl)methyl]piperidin-4-yl]benzimidazol-2-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 144722224 |
| Molecular Formula | C25H38N4 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 2-[1-[1-[(5,5-dimethylcyclohexen-1-yl)methyl]piperidin-4-yl]benzimidazol-2-yl]-N-ethylethanamine |
| SMILES | CCNCCc1nc2ccccc2n1C1CCN(CC2=CCCC(C)(C)C2)CC1 |
| InChI | InChI=1S/C25H38N4/c1-4-26-15-11-24-27-22-9-5-6-10-23(22)29(24)21-12-16-28(17-13-21)19-20-8-7-14-25(2,3)18-20/h5-6,8-10,21,26H,4,7,11-19H2,1-3H3 |
| InChIKey | OYFWICYIADOWGV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|