C12H15N3 — CID 43142730
1-(1-cyclopropylbenzimidazol-2-yl)-N-methylmethanamine (PubChem CID 43142730) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-(1-cyclopropylbenzimidazol-2-yl)-N-methylmethanamine.
| Compound Name | 1-(1-cyclopropylbenzimidazol-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 43142730 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 1-(1-cyclopropylbenzimidazol-2-yl)-N-methylmethanamine |
| SMILES | CNCc1nc2ccccc2n1C1CC1 |
| InChI | InChI=1S/C12H15N3/c1-13-8-12-14-10-4-2-3-5-11(10)15(12)9-6-7-9/h2-5,9,13H,6-8H2,1H3 |
| InChIKey | IIAVHZQHJRBATG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |